What is the 1-Phenyl-2-nitropropene?

1-Phenyl-2-nitropropene is Yellow crystalline powder, while it's Molecular Formula is C9H9NO2. Yellow crystalline powder 1-phenyl-2-nitropropene is used in the production of pharmaceuticals, for instance, for drug Adderall, a drug used to treat ADHD and narcolepsy.

What is the CAS number for 1-Phenyl-2-nitropropene?

The CAS number of 1-Phenyl-2-nitropropene is 705-60-2.

What is 1-Phenyl-2-nitropropene (705-60-2) used for?

InChI:InChI=1/C9H9NO2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-7H,1H3/b8-7+

What is the 1-Phenyl-2-nitropropene?

1-Phenyl-2-nitropropene is Yellow crystalline powder, while it's Molecular Formula is C9H9NO2. Yellow crystalline powder 1-phenyl-2-nitropropene is used in the production of pharmaceuticals, for instance, for drug Adderall, a drug used to treat ADHD and narcolepsy.